4-bromo-1-ethyl-N'-[(5-fluorothiophen-2-yl)methylidene]-1H-pyrazole-3-carbohydrazide
Chemical Structure Depiction of
4-bromo-1-ethyl-N'-[(5-fluorothiophen-2-yl)methylidene]-1H-pyrazole-3-carbohydrazide
4-bromo-1-ethyl-N'-[(5-fluorothiophen-2-yl)methylidene]-1H-pyrazole-3-carbohydrazide
Compound characteristics
| Compound ID: | Y505-3987 |
| Compound Name: | 4-bromo-1-ethyl-N'-[(5-fluorothiophen-2-yl)methylidene]-1H-pyrazole-3-carbohydrazide |
| Molecular Weight: | 345.19 |
| Molecular Formula: | C11 H10 Br F N4 O S |
| Smiles: | CCn1cc(c(C(N/N=C/c2ccc(F)s2)=O)n1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.8317 |
| logD: | 2.8236 |
| logSw: | -3.1603 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.621 |
| InChI Key: | ZKUZKVBRPSDMEF-UHFFFAOYSA-N |