(2,5-dimethoxyphenyl)(morpholin-4-yl)methanethione
Chemical Structure Depiction of
(2,5-dimethoxyphenyl)(morpholin-4-yl)methanethione
(2,5-dimethoxyphenyl)(morpholin-4-yl)methanethione
Compound characteristics
| Compound ID: | Y505-4371 |
| Compound Name: | (2,5-dimethoxyphenyl)(morpholin-4-yl)methanethione |
| Molecular Weight: | 267.34 |
| Molecular Formula: | C13 H17 N O3 S |
| Smiles: | COc1ccc(c(c1)C(N1CCOCC1)=S)OC |
| Stereo: | ACHIRAL |
| logP: | 2.1435 |
| logD: | 2.1435 |
| logSw: | -2.6937 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 25.2695 |
| InChI Key: | ADHQUNYXOLRGJQ-UHFFFAOYSA-N |