N'-[(2-hydroxy-3-methoxyphenyl)methylidene]naphtho[2,1-b]furan-2-carbohydrazide
Chemical Structure Depiction of
N'-[(2-hydroxy-3-methoxyphenyl)methylidene]naphtho[2,1-b]furan-2-carbohydrazide
N'-[(2-hydroxy-3-methoxyphenyl)methylidene]naphtho[2,1-b]furan-2-carbohydrazide
Compound characteristics
| Compound ID: | Y505-4615 |
| Compound Name: | N'-[(2-hydroxy-3-methoxyphenyl)methylidene]naphtho[2,1-b]furan-2-carbohydrazide |
| Molecular Weight: | 360.37 |
| Molecular Formula: | C21 H16 N2 O4 |
| Smiles: | COc1cccc(/C=N/NC(c2cc3c4ccccc4ccc3o2)=O)c1O |
| Stereo: | ACHIRAL |
| logP: | 4.7415 |
| logD: | 4.7387 |
| logSw: | -5.4313 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.685 |
| InChI Key: | PQUBKYSJGWTHRH-UHFFFAOYSA-N |