methyl (2-ethoxy-4-formylphenoxy)acetate
Chemical Structure Depiction of
methyl (2-ethoxy-4-formylphenoxy)acetate
methyl (2-ethoxy-4-formylphenoxy)acetate
Compound characteristics
| Compound ID: | Y505-4664 |
| Compound Name: | methyl (2-ethoxy-4-formylphenoxy)acetate |
| Molecular Weight: | 238.24 |
| Molecular Formula: | C12 H14 O5 |
| Smiles: | CCOc1cc(C=O)ccc1OCC(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 0.8005 |
| logD: | 0.8005 |
| logSw: | -1.5515 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.772 |
| InChI Key: | DZYBXVLDFNWLLY-UHFFFAOYSA-N |