3-{[2-(benzenesulfonyl)hydrazinylidene]methyl}phenyl 4-methoxybenzoate
Chemical Structure Depiction of
3-{[2-(benzenesulfonyl)hydrazinylidene]methyl}phenyl 4-methoxybenzoate
3-{[2-(benzenesulfonyl)hydrazinylidene]methyl}phenyl 4-methoxybenzoate
Compound characteristics
| Compound ID: | Y505-4683 |
| Compound Name: | 3-{[2-(benzenesulfonyl)hydrazinylidene]methyl}phenyl 4-methoxybenzoate |
| Molecular Weight: | 410.45 |
| Molecular Formula: | C21 H18 N2 O5 S |
| Smiles: | COc1ccc(cc1)C(=O)Oc1cccc(/C=N/NS(c2ccccc2)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.4777 |
| logD: | 1.7425 |
| logSw: | -3.9616 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.75 |
| InChI Key: | NQLTYTIGSNRAGT-UHFFFAOYSA-N |