2-[4-chloro-3,5-bis(3-methylphenyl)-1H-pyrazol-1-yl]-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine
Chemical Structure Depiction of
2-[4-chloro-3,5-bis(3-methylphenyl)-1H-pyrazol-1-yl]-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine
2-[4-chloro-3,5-bis(3-methylphenyl)-1H-pyrazol-1-yl]-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine
Compound characteristics
| Compound ID: | Y505-5133 |
| Compound Name: | 2-[4-chloro-3,5-bis(3-methylphenyl)-1H-pyrazol-1-yl]-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine |
| Molecular Weight: | 534.97 |
| Molecular Formula: | C29 H22 Cl F3 N4 O |
| Smiles: | Cc1cccc(c1)c1c(c(c2cccc(C)c2)n(c2nc(cc(C(F)(F)F)n2)c2cccc(c2)OC)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 8.683 |
| logD: | 8.683 |
| logSw: | -7.0159 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.107 |
| InChI Key: | MIZWPOWDZMQMLI-UHFFFAOYSA-N |