4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]-3,5-bis(4-methoxyphenyl)-1H-pyrazole
Chemical Structure Depiction of
4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]-3,5-bis(4-methoxyphenyl)-1H-pyrazole
4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]-3,5-bis(4-methoxyphenyl)-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-5245 |
| Compound Name: | 4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]-3,5-bis(4-methoxyphenyl)-1H-pyrazole |
| Molecular Weight: | 457.33 |
| Molecular Formula: | C24 H19 Cl2 F N2 O2 |
| Smiles: | COc1ccc(cc1)c1c(c(c2ccc(cc2)OC)n(Cc2c(cccc2[Cl])F)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.2858 |
| logD: | 6.2858 |
| logSw: | -6.5895 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.2876 |
| InChI Key: | DPHORFMPSZZGER-UHFFFAOYSA-N |