1-[(2-chloro-4-fluorophenyl)methyl]-3,5-bis(2,4-dimethoxyphenyl)-1H-pyrazole
Chemical Structure Depiction of
1-[(2-chloro-4-fluorophenyl)methyl]-3,5-bis(2,4-dimethoxyphenyl)-1H-pyrazole
1-[(2-chloro-4-fluorophenyl)methyl]-3,5-bis(2,4-dimethoxyphenyl)-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-5304 |
| Compound Name: | 1-[(2-chloro-4-fluorophenyl)methyl]-3,5-bis(2,4-dimethoxyphenyl)-1H-pyrazole |
| Molecular Weight: | 482.94 |
| Molecular Formula: | C26 H24 Cl F N2 O4 |
| Smiles: | COc1ccc(c(c1)OC)c1cc(c2ccc(cc2OC)OC)n(Cc2ccc(cc2[Cl])F)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.2468 |
| logD: | 6.2468 |
| logSw: | -6.3081 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 43.002 |
| InChI Key: | ONTVEZXYFHWZGO-UHFFFAOYSA-N |