1-(3,4-dimethylphenyl)-3,5-bis(4-methoxyphenyl)-4-methyl-1H-pyrazole
Chemical Structure Depiction of
1-(3,4-dimethylphenyl)-3,5-bis(4-methoxyphenyl)-4-methyl-1H-pyrazole
1-(3,4-dimethylphenyl)-3,5-bis(4-methoxyphenyl)-4-methyl-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-5464 |
| Compound Name: | 1-(3,4-dimethylphenyl)-3,5-bis(4-methoxyphenyl)-4-methyl-1H-pyrazole |
| Molecular Weight: | 398.5 |
| Molecular Formula: | C26 H26 N2 O2 |
| Smiles: | Cc1ccc(cc1C)n1c(c2ccc(cc2)OC)c(C)c(c2ccc(cc2)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.6687 |
| logD: | 6.6687 |
| logSw: | -5.8376 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.4238 |
| InChI Key: | RUYNIVWLFBZXML-UHFFFAOYSA-N |