2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine
Chemical Structure Depiction of
2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine
2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine
Compound characteristics
| Compound ID: | Y505-5859 |
| Compound Name: | 2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(furan-2-yl)-6-(trifluoromethyl)pyrimidine |
| Molecular Weight: | 308.26 |
| Molecular Formula: | C14 H11 F3 N4 O |
| Smiles: | Cc1cc(C)n(c2nc(cc(C(F)(F)F)n2)c2ccco2)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.0325 |
| logD: | 3.0325 |
| logSw: | -2.938 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.915 |
| InChI Key: | GCRBIVLKNRBOAR-UHFFFAOYSA-N |