2-[3,5-bis(3,4-dimethylphenyl)-4-methyl-1H-pyrazol-1-yl]-4-(4-chlorophenyl)-1,3-thiazole
Chemical Structure Depiction of
2-[3,5-bis(3,4-dimethylphenyl)-4-methyl-1H-pyrazol-1-yl]-4-(4-chlorophenyl)-1,3-thiazole
2-[3,5-bis(3,4-dimethylphenyl)-4-methyl-1H-pyrazol-1-yl]-4-(4-chlorophenyl)-1,3-thiazole
Compound characteristics
| Compound ID: | Y505-5975 |
| Compound Name: | 2-[3,5-bis(3,4-dimethylphenyl)-4-methyl-1H-pyrazol-1-yl]-4-(4-chlorophenyl)-1,3-thiazole |
| Molecular Weight: | 484.06 |
| Molecular Formula: | C29 H26 Cl N3 S |
| Smiles: | Cc1ccc(cc1C)c1c(C)c(c2ccc(C)c(C)c2)n(c2nc(cs2)c2ccc(cc2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 9.9505 |
| logD: | 9.9505 |
| logSw: | -6.8375 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 22.8851 |
| InChI Key: | BRADGMBTADYSKV-UHFFFAOYSA-N |