2-[4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazol-1-yl]-4-(4-methoxyphenyl)-1,3-thiazole
Chemical Structure Depiction of
2-[4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazol-1-yl]-4-(4-methoxyphenyl)-1,3-thiazole
2-[4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazol-1-yl]-4-(4-methoxyphenyl)-1,3-thiazole
Compound characteristics
| Compound ID: | Y505-6003 |
| Compound Name: | 2-[4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazol-1-yl]-4-(4-methoxyphenyl)-1,3-thiazole |
| Molecular Weight: | 497.62 |
| Molecular Formula: | C29 H27 N3 O3 S |
| Smiles: | CCc1c(c2cccc(c2)OC)nn(c1c1cccc(c1)OC)c1nc(cs1)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 8.0252 |
| logD: | 8.0252 |
| logSw: | -5.8837 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.516 |
| InChI Key: | AUBFXERHGDIBQI-UHFFFAOYSA-N |