4-chloro-1-[(2,4-dichlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-1H-pyrazole
Chemical Structure Depiction of
4-chloro-1-[(2,4-dichlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-1H-pyrazole
4-chloro-1-[(2,4-dichlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-6112 |
| Compound Name: | 4-chloro-1-[(2,4-dichlorophenyl)methyl]-3,5-bis(3,4-dimethylphenyl)-1H-pyrazole |
| Molecular Weight: | 469.84 |
| Molecular Formula: | C26 H23 Cl3 N2 |
| Smiles: | Cc1ccc(cc1C)c1c(c(c2ccc(C)c(C)c2)n(Cc2ccc(cc2[Cl])[Cl])n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 9.2239 |
| logD: | 9.2239 |
| logSw: | -7.2799 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 13.2001 |
| InChI Key: | NNTBQPJQYDAWFI-UHFFFAOYSA-N |