1-[(2,5-dimethylphenyl)methyl]-4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole
Chemical Structure Depiction of
1-[(2,5-dimethylphenyl)methyl]-4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole
1-[(2,5-dimethylphenyl)methyl]-4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-6178 |
| Compound Name: | 1-[(2,5-dimethylphenyl)methyl]-4-ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole |
| Molecular Weight: | 426.56 |
| Molecular Formula: | C28 H30 N2 O2 |
| Smiles: | CCc1c(c2cccc(c2)OC)nn(Cc2cc(C)ccc2C)c1c1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 7.4498 |
| logD: | 7.4497 |
| logSw: | -5.7514 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.2876 |
| InChI Key: | SCZDRPOPUIKEFF-UHFFFAOYSA-N |