3,5-bis(3,4-dimethylphenyl)-4-methyl-1-(3-methylphenyl)-1H-pyrazole
Chemical Structure Depiction of
3,5-bis(3,4-dimethylphenyl)-4-methyl-1-(3-methylphenyl)-1H-pyrazole
3,5-bis(3,4-dimethylphenyl)-4-methyl-1-(3-methylphenyl)-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-6635 |
| Compound Name: | 3,5-bis(3,4-dimethylphenyl)-4-methyl-1-(3-methylphenyl)-1H-pyrazole |
| Molecular Weight: | 380.53 |
| Molecular Formula: | C27 H28 N2 |
| Smiles: | Cc1cccc(c1)n1c(c2ccc(C)c(C)c2)c(C)c(c2ccc(C)c(C)c2)n1 |
| Stereo: | ACHIRAL |
| logP: | 8.2146 |
| logD: | 8.2146 |
| logSw: | -5.9457 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 13.3363 |
| InChI Key: | JGPZTCDQZBVKMP-UHFFFAOYSA-N |