3,5-bis(4-fluorophenyl)-1-[(4-methylphenyl)methyl]-1H-pyrazole
Chemical Structure Depiction of
3,5-bis(4-fluorophenyl)-1-[(4-methylphenyl)methyl]-1H-pyrazole
3,5-bis(4-fluorophenyl)-1-[(4-methylphenyl)methyl]-1H-pyrazole
Compound characteristics
| Compound ID: | Y505-6726 |
| Compound Name: | 3,5-bis(4-fluorophenyl)-1-[(4-methylphenyl)methyl]-1H-pyrazole |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C23 H18 F2 N2 |
| Smiles: | Cc1ccc(Cn2c(cc(c3ccc(cc3)F)n2)c2ccc(cc2)F)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.3218 |
| logD: | 6.3218 |
| logSw: | -5.7043 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 12.6537 |
| InChI Key: | LLLKXYVQKNUPAO-UHFFFAOYSA-N |