methyl 1-[(1~1~,3~1~-dimethyl-1~1~H,2~1~H,3~1~H-[1~4~,2~3~:2~5~,3~4~-terpyrazol]-2~1~-yl)methyl]-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
methyl 1-[(1~1~,3~1~-dimethyl-1~1~H,2~1~H,3~1~H-[1~4~,2~3~:2~5~,3~4~-terpyrazol]-2~1~-yl)methyl]-1H-pyrazole-3-carboxylate
methyl 1-[(1~1~,3~1~-dimethyl-1~1~H,2~1~H,3~1~H-[1~4~,2~3~:2~5~,3~4~-terpyrazol]-2~1~-yl)methyl]-1H-pyrazole-3-carboxylate
Compound characteristics
| Compound ID: | Y505-6953 |
| Compound Name: | methyl 1-[(1~1~,3~1~-dimethyl-1~1~H,2~1~H,3~1~H-[1~4~,2~3~:2~5~,3~4~-terpyrazol]-2~1~-yl)methyl]-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 366.38 |
| Molecular Formula: | C17 H18 N8 O2 |
| Smiles: | Cn1cc(cn1)c1cc(c2cnn(C)c2)n(Cn2ccc(C(=O)OC)n2)n1 |
| Stereo: | ACHIRAL |
| logP: | 0.2229 |
| logD: | 0.2229 |
| logSw: | -1.1726 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 79.528 |
| InChI Key: | RIZSJKHDYCIQSR-UHFFFAOYSA-N |