2~4~-chloro-2~1~-(4-chlorophenyl)-1~1~,1~5~,3~1~,3~5~-tetramethyl-1~1~H,2~1~H,3~1~H-1~4~,2~3~:2~5~,3~4~-terpyrazole
Chemical Structure Depiction of
2~4~-chloro-2~1~-(4-chlorophenyl)-1~1~,1~5~,3~1~,3~5~-tetramethyl-1~1~H,2~1~H,3~1~H-1~4~,2~3~:2~5~,3~4~-terpyrazole
2~4~-chloro-2~1~-(4-chlorophenyl)-1~1~,1~5~,3~1~,3~5~-tetramethyl-1~1~H,2~1~H,3~1~H-1~4~,2~3~:2~5~,3~4~-terpyrazole
Compound characteristics
| Compound ID: | Y505-7013 |
| Compound Name: | 2~4~-chloro-2~1~-(4-chlorophenyl)-1~1~,1~5~,3~1~,3~5~-tetramethyl-1~1~H,2~1~H,3~1~H-1~4~,2~3~:2~5~,3~4~-terpyrazole |
| Molecular Weight: | 401.3 |
| Molecular Formula: | C19 H18 Cl2 N6 |
| Smiles: | Cc1c(cnn1C)c1c(c(c2cnn(C)c2C)n(c2ccc(cc2)[Cl])n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7231 |
| logD: | 3.7231 |
| logSw: | -4.5703 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 42.309 |
| InChI Key: | KICYFWALDPSOLN-UHFFFAOYSA-N |