3-[(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde
Chemical Structure Depiction of
3-[(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde
3-[(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde
Compound characteristics
| Compound ID: | Y507-1562 |
| Compound Name: | 3-[(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde |
| Molecular Weight: | 278.74 |
| Molecular Formula: | C14 H15 Cl N2 O2 |
| Smiles: | Cc1c(c(C)n(Cc2cc(C=O)ccc2OC)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.3723 |
| logD: | 2.3723 |
| logSw: | -3.4504 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.31 |
| InChI Key: | QXZWDHGCGQIEGG-UHFFFAOYSA-N |