methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y507-1744 |
| Compound Name: | methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Molecular Weight: | 287.38 |
| Molecular Formula: | C16 H17 N O2 S |
| Smiles: | COC(c1c2CCC(Cc2sc1N)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8319 |
| logD: | 3.8319 |
| logSw: | -4.3702 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.338 |
| InChI Key: | BVXJDKFMMQTUGI-LLVKDONJSA-N |