4-fluoro-N-[(1H-indol-3-yl)methyl]aniline
Chemical Structure Depiction of
4-fluoro-N-[(1H-indol-3-yl)methyl]aniline
4-fluoro-N-[(1H-indol-3-yl)methyl]aniline
Compound characteristics
| Compound ID: | Y507-1984 |
| Compound Name: | 4-fluoro-N-[(1H-indol-3-yl)methyl]aniline |
| Molecular Weight: | 240.28 |
| Molecular Formula: | C15 H13 F N2 |
| Smiles: | C(c1c[nH]c2ccccc12)Nc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.6399 |
| logD: | 3.6398 |
| logSw: | -4.1256 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 20.3437 |
| InChI Key: | MDPHUMVCHPMXFO-UHFFFAOYSA-N |