5-amino-2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
5-amino-2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4-carboxamide
5-amino-2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | Y507-2000 |
| Compound Name: | 5-amino-2-(4-methyl-3-nitrophenyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 262.22 |
| Molecular Formula: | C11 H10 N4 O4 |
| Smiles: | Cc1ccc(cc1[N+]([O-])=O)c1nc(C(N)=O)c(N)o1 |
| Stereo: | ACHIRAL |
| logP: | 0.9275 |
| logD: | 0.9275 |
| logSw: | -1.8356 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 106.379 |
| InChI Key: | SDQFNSNMSDORRQ-UHFFFAOYSA-N |