N,N'-bis(3-chlorophenyl)thiourea
Chemical Structure Depiction of
N,N'-bis(3-chlorophenyl)thiourea
N,N'-bis(3-chlorophenyl)thiourea
Compound characteristics
| Compound ID: | Y507-3106 |
| Compound Name: | N,N'-bis(3-chlorophenyl)thiourea |
| Molecular Weight: | 297.2 |
| Molecular Formula: | C13 H10 Cl2 N2 S |
| Smiles: | c1cc(cc(c1)[Cl])NC(Nc1cccc(c1)[Cl])=S |
| Stereo: | ACHIRAL |
| logP: | 5.3071 |
| logD: | 5.307 |
| logSw: | -6.0299 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 19.0609 |
| InChI Key: | DDMUCNBBNKTNCX-UHFFFAOYSA-N |