methyl 1-[(4-chlorophenyl)methyl]-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
methyl 1-[(4-chlorophenyl)methyl]-1H-pyrazole-3-carboxylate
methyl 1-[(4-chlorophenyl)methyl]-1H-pyrazole-3-carboxylate
Compound characteristics
| Compound ID: | Y507-3963 |
| Compound Name: | methyl 1-[(4-chlorophenyl)methyl]-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 250.68 |
| Molecular Formula: | C12 H11 Cl N2 O2 |
| Smiles: | COC(c1ccn(Cc2ccc(cc2)[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2154 |
| logD: | 2.2154 |
| logSw: | -2.7823 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.801 |
| InChI Key: | DNKGLPZDQQFURM-UHFFFAOYSA-N |