4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methyl-1H-pyrazole
Chemical Structure Depiction of
4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methyl-1H-pyrazole
4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methyl-1H-pyrazole
Compound characteristics
| Compound ID: | Y507-4511 |
| Compound Name: | 4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methyl-1H-pyrazole |
| Molecular Weight: | 251.21 |
| Molecular Formula: | C11 H10 F N3 O3 |
| Smiles: | Cn1cc(COc2ccc(cc2F)[N+]([O-])=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 1.8057 |
| logD: | 1.8057 |
| logSw: | -2.0175 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.743 |
| InChI Key: | VYTOPNIWPYXLHB-UHFFFAOYSA-N |