1-[2-(2-fluoro-4-nitrophenoxy)ethyl]pyrrolidine
Chemical Structure Depiction of
1-[2-(2-fluoro-4-nitrophenoxy)ethyl]pyrrolidine
1-[2-(2-fluoro-4-nitrophenoxy)ethyl]pyrrolidine
Compound characteristics
| Compound ID: | Y507-4562 |
| Compound Name: | 1-[2-(2-fluoro-4-nitrophenoxy)ethyl]pyrrolidine |
| Molecular Weight: | 254.26 |
| Molecular Formula: | C12 H15 F N2 O3 |
| Smiles: | C1CCN(C1)CCOc1ccc(cc1F)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.5798 |
| logD: | 1.2309 |
| logSw: | -2.6892 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.201 |
| InChI Key: | INZRDRWRCZWASO-UHFFFAOYSA-N |