N,1-diethyl-4-nitro-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N,1-diethyl-4-nitro-1H-pyrazole-3-carboxamide
N,1-diethyl-4-nitro-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | Y507-4952 |
| Compound Name: | N,1-diethyl-4-nitro-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 212.2 |
| Molecular Formula: | C8 H12 N4 O3 |
| Smiles: | CCNC(c1c(cn(CC)n1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.0144 |
| logD: | 0.0144 |
| logSw: | -1.5112 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.678 |
| InChI Key: | BRZFVCLRWSKESG-UHFFFAOYSA-N |