2-{2-[bis(4-methoxyphenyl)methylidene]hydrazinyl}benzoic acid
Chemical Structure Depiction of
2-{2-[bis(4-methoxyphenyl)methylidene]hydrazinyl}benzoic acid
2-{2-[bis(4-methoxyphenyl)methylidene]hydrazinyl}benzoic acid
Compound characteristics
| Compound ID: | Y508-0738 |
| Compound Name: | 2-{2-[bis(4-methoxyphenyl)methylidene]hydrazinyl}benzoic acid |
| Molecular Weight: | 376.41 |
| Molecular Formula: | C22 H20 N2 O4 |
| Smiles: | [H]N(c1ccccc1C(O)=O)N=C(c1ccc(cc1)OC)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.8815 |
| logD: | 2.3393 |
| logSw: | -5.3707 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.42 |
| InChI Key: | UCMMLUOVWVNVDJ-UHFFFAOYSA-N |