N-(3-methoxy-5-nitrophenyl)furan-2-carboxamide
Chemical Structure Depiction of
N-(3-methoxy-5-nitrophenyl)furan-2-carboxamide
N-(3-methoxy-5-nitrophenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | Y508-1091 |
| Compound Name: | N-(3-methoxy-5-nitrophenyl)furan-2-carboxamide |
| Molecular Weight: | 262.22 |
| Molecular Formula: | C12 H10 N2 O5 |
| Smiles: | COc1cc(cc(c1)[N+]([O-])=O)NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5272 |
| logD: | 2.4412 |
| logSw: | -2.9995 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.833 |
| InChI Key: | SHCYLALWFKFBSE-UHFFFAOYSA-N |