1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl N'-(4-bromophenyl)-N-ethylcarbamimidothioate
Chemical Structure Depiction of
1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl N'-(4-bromophenyl)-N-ethylcarbamimidothioate
1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl N'-(4-bromophenyl)-N-ethylcarbamimidothioate
Compound characteristics
| Compound ID: | Y508-1666 |
| Compound Name: | 1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl N'-(4-bromophenyl)-N-ethylcarbamimidothioate |
| Molecular Weight: | 511.23 |
| Molecular Formula: | C19 H17 Br2 N3 O2 S |
| Smiles: | CCN\C(=N/c1ccc(cc1)[Br])SC1CC(N(C1=O)c1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2137 |
| logD: | 4.2128 |
| logSw: | -4.1572 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.665 |
| InChI Key: | KHNNBZSLNVWRSC-INIZCTEOSA-N |