2-hydroxy-N'-[(3-methylthiophen-2-yl)methylidene]-2,2-diphenylacetohydrazide
Chemical Structure Depiction of
2-hydroxy-N'-[(3-methylthiophen-2-yl)methylidene]-2,2-diphenylacetohydrazide
2-hydroxy-N'-[(3-methylthiophen-2-yl)methylidene]-2,2-diphenylacetohydrazide
Compound characteristics
| Compound ID: | Y508-2459 |
| Compound Name: | 2-hydroxy-N'-[(3-methylthiophen-2-yl)methylidene]-2,2-diphenylacetohydrazide |
| Molecular Weight: | 350.44 |
| Molecular Formula: | C20 H18 N2 O2 S |
| Smiles: | Cc1ccsc1/C=N/NC(C(c1ccccc1)(c1ccccc1)O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9957 |
| logD: | 3.9933 |
| logSw: | -4.0338 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.369 |
| InChI Key: | CFGKCBPIVPKVJO-UHFFFAOYSA-N |