1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(thiophen-2-yl)prop-2-en-1-one
Chemical Structure Depiction of
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(thiophen-2-yl)prop-2-en-1-one
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(thiophen-2-yl)prop-2-en-1-one
Compound characteristics
| Compound ID: | Y508-2662 |
| Compound Name: | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(thiophen-2-yl)prop-2-en-1-one |
| Molecular Weight: | 332.85 |
| Molecular Formula: | C17 H17 Cl N2 O S |
| Smiles: | C1CN(CCN1C(/C=C/c1cccs1)=O)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.6138 |
| logD: | 3.6138 |
| logSw: | -3.9257 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.638 |
| InChI Key: | UREWVHVDZAQPKG-UHFFFAOYSA-N |