4-({4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl}methylidene)-2-(naphthalen-1-yl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-({4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl}methylidene)-2-(naphthalen-1-yl)-1,3-oxazol-5(4H)-one
4-({4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl}methylidene)-2-(naphthalen-1-yl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | Y508-2806 |
| Compound Name: | 4-({4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl}methylidene)-2-(naphthalen-1-yl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 595.82 |
| Molecular Formula: | C28 H19 Cl I N O4 |
| Smiles: | COc1cc(/C=C2/C(=O)OC(c3cccc4ccccc34)=N2)cc(c1OCc1ccccc1[Cl])I |
| Stereo: | ACHIRAL |
| logP: | 6.9839 |
| logD: | 6.9839 |
| logSw: | -6.5505 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.135 |
| InChI Key: | JELXRZJSBAUQHB-UHFFFAOYSA-N |