1-[(2,6-dichlorophenoxy)methyl]-N-(3-methylphenyl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
1-[(2,6-dichlorophenoxy)methyl]-N-(3-methylphenyl)-1H-pyrazole-3-carboxamide
1-[(2,6-dichlorophenoxy)methyl]-N-(3-methylphenyl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | Y508-4976 |
| Compound Name: | 1-[(2,6-dichlorophenoxy)methyl]-N-(3-methylphenyl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 376.24 |
| Molecular Formula: | C18 H15 Cl2 N3 O2 |
| Smiles: | Cc1cccc(c1)NC(c1ccn(COc2c(cccc2[Cl])[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6003 |
| logD: | 4.6003 |
| logSw: | -4.5614 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.866 |
| InChI Key: | AJLNOMOCMFOLEY-UHFFFAOYSA-N |