N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)ethan-1-amine
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)ethan-1-amine
N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)ethan-1-amine
Compound characteristics
| Compound ID: | Y508-5808 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-(1H-indol-3-yl)ethan-1-amine |
| Molecular Weight: | 268.33 |
| Molecular Formula: | C17 H17 F N2 |
| Smiles: | C(CNCc1ccc(cc1)F)c1c[nH]c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.068 |
| logD: | 1.777 |
| logSw: | -2.936 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 21.72 |
| InChI Key: | GNAOYSCNQZGVBP-UHFFFAOYSA-N |