1-(2,4-dichlorophenyl)-3-(4-methylpiperidin-1-yl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(2,4-dichlorophenyl)-3-(4-methylpiperidin-1-yl)pyrrolidine-2,5-dione
1-(2,4-dichlorophenyl)-3-(4-methylpiperidin-1-yl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | Y508-6650 |
| Compound Name: | 1-(2,4-dichlorophenyl)-3-(4-methylpiperidin-1-yl)pyrrolidine-2,5-dione |
| Molecular Weight: | 341.24 |
| Molecular Formula: | C16 H18 Cl2 N2 O2 |
| Smiles: | CC1CCN(CC1)C1CC(N(C1=O)c1ccc(cc1[Cl])[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7424 |
| logD: | 2.7423 |
| logSw: | -3.3473 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.687 |
| InChI Key: | QUULLSMVVWQKDM-CQSZACIVSA-N |