3-[(4-fluorophenoxy)methyl]-4-methoxybenzaldehyde
Chemical Structure Depiction of
3-[(4-fluorophenoxy)methyl]-4-methoxybenzaldehyde
3-[(4-fluorophenoxy)methyl]-4-methoxybenzaldehyde
Compound characteristics
| Compound ID: | Y508-7845 |
| Compound Name: | 3-[(4-fluorophenoxy)methyl]-4-methoxybenzaldehyde |
| Molecular Weight: | 260.26 |
| Molecular Formula: | C15 H13 F O3 |
| Smiles: | COc1ccc(C=O)cc1COc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.0292 |
| logD: | 3.0292 |
| logSw: | -3.0008 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.2556 |
| InChI Key: | KRMUDYYSXDSLOC-UHFFFAOYSA-N |