N'-[(anthracen-9-yl)methylidene]-2-(4-methoxyanilino)butanehydrazide
Chemical Structure Depiction of
N'-[(anthracen-9-yl)methylidene]-2-(4-methoxyanilino)butanehydrazide
N'-[(anthracen-9-yl)methylidene]-2-(4-methoxyanilino)butanehydrazide
Compound characteristics
| Compound ID: | Y508-8080 |
| Compound Name: | N'-[(anthracen-9-yl)methylidene]-2-(4-methoxyanilino)butanehydrazide |
| Molecular Weight: | 411.5 |
| Molecular Formula: | C26 H25 N3 O2 |
| Smiles: | CCC(C(N/N=C/c1c2ccccc2cc2ccccc12)=O)Nc1ccc(cc1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3877 |
| logD: | 6.3864 |
| logSw: | -6.572 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.691 |
| InChI Key: | OCMRTMDPBNMKFC-VWLOTQADSA-N |