10-[(4-chlorophenyl)acetyl]-3,3-dimethyl-11-[5-(2-nitrophenyl)furan-2-yl]-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
Chemical Structure Depiction of
10-[(4-chlorophenyl)acetyl]-3,3-dimethyl-11-[5-(2-nitrophenyl)furan-2-yl]-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
10-[(4-chlorophenyl)acetyl]-3,3-dimethyl-11-[5-(2-nitrophenyl)furan-2-yl]-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one
Compound characteristics
| Compound ID: | Y508-8463 |
| Compound Name: | 10-[(4-chlorophenyl)acetyl]-3,3-dimethyl-11-[5-(2-nitrophenyl)furan-2-yl]-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one |
| Molecular Weight: | 582.06 |
| Molecular Formula: | C33 H28 Cl N3 O5 |
| Smiles: | CC1(C)CC2=C(C(c3ccc(c4ccccc4[N+]([O-])=O)o3)N(C(Cc3ccc(cc3)[Cl])=O)c3ccccc3N2)C(C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8788 |
| logD: | 6.6613 |
| logSw: | -6.2131 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.117 |
| InChI Key: | FYZFYYPNORHRMT-YTTGMZPUSA-N |