1-{5-[(3,4-dichlorophenoxy)methyl]furan-2-yl}-N-[3-(ethylsulfanyl)-5-methyl-4H-1,2,4-triazol-4-yl]methanimine
Chemical Structure Depiction of
1-{5-[(3,4-dichlorophenoxy)methyl]furan-2-yl}-N-[3-(ethylsulfanyl)-5-methyl-4H-1,2,4-triazol-4-yl]methanimine
1-{5-[(3,4-dichlorophenoxy)methyl]furan-2-yl}-N-[3-(ethylsulfanyl)-5-methyl-4H-1,2,4-triazol-4-yl]methanimine
Compound characteristics
| Compound ID: | Y508-8845 |
| Compound Name: | 1-{5-[(3,4-dichlorophenoxy)methyl]furan-2-yl}-N-[3-(ethylsulfanyl)-5-methyl-4H-1,2,4-triazol-4-yl]methanimine |
| Molecular Weight: | 411.31 |
| Molecular Formula: | C17 H16 Cl2 N4 O2 S |
| Smiles: | CCSc1nnc(C)n1/N=C/c1ccc(COc2ccc(c(c2)[Cl])[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.5871 |
| logD: | 4.587 |
| logSw: | -4.6654 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.893 |
| InChI Key: | NTLHMZUGNYFJNG-UHFFFAOYSA-N |