methyl 4-(4-chloro-2-fluoroanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate
Chemical Structure Depiction of
methyl 4-(4-chloro-2-fluoroanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate
methyl 4-(4-chloro-2-fluoroanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate
Compound characteristics
| Compound ID: | Y508-9138 |
| Compound Name: | methyl 4-(4-chloro-2-fluoroanilino)-2-hydroxy-4-oxo-2-(trifluoromethyl)butanoate |
| Molecular Weight: | 343.66 |
| Molecular Formula: | C12 H10 Cl F4 N O4 |
| Smiles: | COC(C(CC(Nc1ccc(cc1F)[Cl])=O)(C(F)(F)F)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1943 |
| logD: | 2.1661 |
| logSw: | -2.9912 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.399 |
| InChI Key: | VMPZEXAAZRMGSJ-LLVKDONJSA-N |