ethyl 4,5-dimethyl-2-{[(4-methylphenyl)carbamothioyl]amino}thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 4,5-dimethyl-2-{[(4-methylphenyl)carbamothioyl]amino}thiophene-3-carboxylate
ethyl 4,5-dimethyl-2-{[(4-methylphenyl)carbamothioyl]amino}thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y508-9524 |
| Compound Name: | ethyl 4,5-dimethyl-2-{[(4-methylphenyl)carbamothioyl]amino}thiophene-3-carboxylate |
| Molecular Weight: | 348.48 |
| Molecular Formula: | C17 H20 N2 O2 S2 |
| Smiles: | CCOC(c1c(C)c(C)sc1NC(Nc1ccc(C)cc1)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9491 |
| logD: | 4.527 |
| logSw: | -4.7137 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.609 |
| InChI Key: | VDXOWHTVJWWBQQ-UHFFFAOYSA-N |