5-(difluoromethyl)-4-{[(3-methoxyphenyl)methylidene]amino}-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
5-(difluoromethyl)-4-{[(3-methoxyphenyl)methylidene]amino}-4H-1,2,4-triazole-3-thiol
5-(difluoromethyl)-4-{[(3-methoxyphenyl)methylidene]amino}-4H-1,2,4-triazole-3-thiol
Compound characteristics
| Compound ID: | Y508-9925 |
| Compound Name: | 5-(difluoromethyl)-4-{[(3-methoxyphenyl)methylidene]amino}-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 284.28 |
| Molecular Formula: | C11 H10 F2 N4 O S |
| Smiles: | COc1cccc(/C=N/n2c(C(F)F)nnc2S)c1 |
| Stereo: | ACHIRAL |
| logP: | 1.4802 |
| logD: | 0.7344 |
| logSw: | -1.8018 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.894 |
| InChI Key: | OTEUBFHYDFLSCV-UHFFFAOYSA-N |