propan-2-yl 2-[(furan-2-carbonyl)amino]-4-(naphthalen-2-yl)thiophene-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 2-[(furan-2-carbonyl)amino]-4-(naphthalen-2-yl)thiophene-3-carboxylate
propan-2-yl 2-[(furan-2-carbonyl)amino]-4-(naphthalen-2-yl)thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y509-0396 |
| Compound Name: | propan-2-yl 2-[(furan-2-carbonyl)amino]-4-(naphthalen-2-yl)thiophene-3-carboxylate |
| Molecular Weight: | 405.47 |
| Molecular Formula: | C23 H19 N O4 S |
| Smiles: | CC(C)OC(c1c(csc1NC(c1ccco1)=O)c1ccc2ccccc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6305 |
| logD: | 5.4941 |
| logSw: | -6.6076 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.592 |
| InChI Key: | HKPDAFGWVZBQQY-UHFFFAOYSA-N |