2-(3-methoxyphenyl)-N'-(3-phenylprop-2-en-1-ylidene)quinoline-4-carbohydrazide
Chemical Structure Depiction of
2-(3-methoxyphenyl)-N'-(3-phenylprop-2-en-1-ylidene)quinoline-4-carbohydrazide
2-(3-methoxyphenyl)-N'-(3-phenylprop-2-en-1-ylidene)quinoline-4-carbohydrazide
Compound characteristics
| Compound ID: | Y509-0470 |
| Compound Name: | 2-(3-methoxyphenyl)-N'-(3-phenylprop-2-en-1-ylidene)quinoline-4-carbohydrazide |
| Molecular Weight: | 407.47 |
| Molecular Formula: | C26 H21 N3 O2 |
| Smiles: | COc1cccc(c1)c1cc(C(N/N=C/C=C/c2ccccc2)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6546 |
| logD: | 5.654 |
| logSw: | -5.8542 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.789 |
| InChI Key: | VTLTVGHFCVBANH-UHFFFAOYSA-N |