2-(2-ethoxyphenyl)-N-(4-nitrophenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
2-(2-ethoxyphenyl)-N-(4-nitrophenyl)quinoline-4-carboxamide
2-(2-ethoxyphenyl)-N-(4-nitrophenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y509-0478 |
| Compound Name: | 2-(2-ethoxyphenyl)-N-(4-nitrophenyl)quinoline-4-carboxamide |
| Molecular Weight: | 413.43 |
| Molecular Formula: | C24 H19 N3 O4 |
| Smiles: | CCOc1ccccc1c1cc(C(Nc2ccc(cc2)[N+]([O-])=O)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.4703 |
| logD: | 5.4691 |
| logSw: | -5.6808 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.981 |
| InChI Key: | CWTIZUIMKXREDB-UHFFFAOYSA-N |