3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide
Chemical Structure Depiction of
3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide
3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide
Compound characteristics
| Compound ID: | Y509-3430 |
| Compound Name: | 3-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-N-(4-fluoro-2-methylphenyl)prop-2-enamide |
| Molecular Weight: | 301.36 |
| Molecular Formula: | C17 H20 F N3 O |
| Smiles: | CCn1c(C)c(/C=C/C(Nc2ccc(cc2C)F)=O)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.7619 |
| logD: | 2.7619 |
| logSw: | -2.9374 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.696 |
| InChI Key: | MXBFGGRUVBLQAY-UHFFFAOYSA-N |