N-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-N,1,3-trimethyl-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
N-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-N,1,3-trimethyl-1H-pyrazole-4-sulfonamide
N-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-N,1,3-trimethyl-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | Y509-3501 |
| Compound Name: | N-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-N,1,3-trimethyl-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 311.4 |
| Molecular Formula: | C13 H21 N5 O2 S |
| Smiles: | CCn1c(C)c(CN(C)S(c2cn(C)nc2C)(=O)=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 0.151 |
| logD: | 0.151 |
| logSw: | -1.1521 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.89 |
| InChI Key: | YQPPNDNEDFMLGR-UHFFFAOYSA-N |