N-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,4-dimethylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,4-dimethylbenzene-1-sulfonamide
N-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,4-dimethylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y509-3503 |
| Compound Name: | N-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,4-dimethylbenzene-1-sulfonamide |
| Molecular Weight: | 293.39 |
| Molecular Formula: | C14 H19 N3 O2 S |
| Smiles: | Cc1ccc(cc1)S(N(C)Cc1cnn(C)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9469 |
| logD: | 1.9469 |
| logSw: | -2.4462 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.289 |
| InChI Key: | KDYHQVVLKVQHAY-UHFFFAOYSA-N |