N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-N-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-N-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-N-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | Y509-3522 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-N-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 419.5 |
| Molecular Formula: | C19 H25 N5 O4 S |
| Smiles: | Cn1cc(CN(CCc2ccc(c(c2)OC)OC)S(c2cnn(C)c2)(=O)=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 0.4796 |
| logD: | 0.4796 |
| logSw: | -2.16 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 76.2 |
| InChI Key: | ZCFIEQHKNPBSGL-UHFFFAOYSA-N |